About 3-(3-chloro-2-pyridinyl)-N,4-dimethylpentan-2-amine
3-(3-chloro-2-pyridinyl)-N,4-dimethylpentan-2-amine (PubChem CID 63198063) has the molecular formula C12H19ClN2
and a molecular weight of 226.75 g/mol. Its IUPAC name is 3-(3-chloro-2-pyridinyl)-N,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | 3-(3-chloro-2-pyridinyl)-N,4-dimethylpentan-2-amine |
| PubChem CID | 63198063 |
| Molecular Formula | C12H19ClN2 |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 3-(3-chloro-2-pyridinyl)-N,4-dimethylpentan-2-amine |
| SMILES | CNC(C)C(c1ncccc1Cl)C(C)C |
| InChI | InChI=1S/C12H19ClN2/c1-8(2)11(9(3)14-4)12-10(13)6-5-7-15-12/h5-9,11,14H,1-4H3 |
| InChIKey | DSPKIADOCPSNPK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3-chloro-2-pyridinyl)-N,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chloro-2-pyridinyl)-N,4-dimethylpentan-2-amine?
The IUPAC name of 3-(3-chloro-2-pyridinyl)-N,4-dimethylpentan-2-amine (CID 63198063) is 3-(3-chloro-2-pyridinyl)-N,4-dimethylpentan-2-amine.
What is the SMILES notation for 3-(3-chloro-2-pyridinyl)-N,4-dimethylpentan-2-amine?
The canonical SMILES for 3-(3-chloro-2-pyridinyl)-N,4-dimethylpentan-2-amine is CNC(C)C(c1ncccc1Cl)C(C)C.
What is the InChIKey of 3-(3-chloro-2-pyridinyl)-N,4-dimethylpentan-2-amine?
The InChIKey is DSPKIADOCPSNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClN2/c1-8(2)11(9(3)14-4)12-10(13)6-5-7-15-12/h5-9,11,14H,1-4H3.
What are the key properties of 3-(3-chloro-2-pyridinyl)-N,4-dimethylpentan-2-amine?
3-(3-chloro-2-pyridinyl)-N,4-dimethylpentan-2-amine has a molecular weight of 226.75 g/mol, XLogP of 3.08, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-2-pyridinyl)-N,4-dimethylpentan-2-amine is sourced from PubChem (CID 63198063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).