About 1-[2,4-bis(methylsulfonyl)phenyl]pentan-2-one
1-[2,4-bis(methylsulfonyl)phenyl]pentan-2-one (PubChem CID 63199103) has the molecular formula C13H18O5S2
and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[2,4-bis(methylsulfonyl)phenyl]pentan-2-one.
Molecular Properties
| Compound Name | 1-[2,4-bis(methylsulfonyl)phenyl]pentan-2-one |
| PubChem CID | 63199103 |
| Molecular Formula | C13H18O5S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-[2,4-bis(methylsulfonyl)phenyl]pentan-2-one |
| SMILES | CCCC(=O)Cc1ccc(S(C)(=O)=O)cc1S(C)(=O)=O |
| InChI | InChI=1S/C13H18O5S2/c1-4-5-11(14)8-10-6-7-12(19(2,15)16)9-13(10)20(3,17)18/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | JLANVIRFXMXZJG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2,4-bis(methylsulfonyl)phenyl]pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,4-bis(methylsulfonyl)phenyl]pentan-2-one?
The IUPAC name of 1-[2,4-bis(methylsulfonyl)phenyl]pentan-2-one (CID 63199103) is 1-[2,4-bis(methylsulfonyl)phenyl]pentan-2-one.
What is the SMILES notation for 1-[2,4-bis(methylsulfonyl)phenyl]pentan-2-one?
The canonical SMILES for 1-[2,4-bis(methylsulfonyl)phenyl]pentan-2-one is CCCC(=O)Cc1ccc(S(C)(=O)=O)cc1S(C)(=O)=O.
What is the InChIKey of 1-[2,4-bis(methylsulfonyl)phenyl]pentan-2-one?
The InChIKey is JLANVIRFXMXZJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O5S2/c1-4-5-11(14)8-10-6-7-12(19(2,15)16)9-13(10)20(3,17)18/h6-7,9H,4-5,8H2,1-3H3.
What are the key properties of 1-[2,4-bis(methylsulfonyl)phenyl]pentan-2-one?
1-[2,4-bis(methylsulfonyl)phenyl]pentan-2-one has a molecular weight of 318.42 g/mol, XLogP of 1.41, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,4-bis(methylsulfonyl)phenyl]pentan-2-one is sourced from PubChem (CID 63199103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).