About 1-(tetrazolo[1,5-a]pyrazin-5-yl)pentan-2-one
1-(tetrazolo[1,5-a]pyrazin-5-yl)pentan-2-one (PubChem CID 63199240) has the molecular formula C9H11N5O
and a molecular weight of 205.22 g/mol. Its IUPAC name is 1-(tetrazolo[1,5-a]pyrazin-5-yl)pentan-2-one.
Molecular Properties
| Compound Name | 1-(tetrazolo[1,5-a]pyrazin-5-yl)pentan-2-one |
| PubChem CID | 63199240 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 1-(tetrazolo[1,5-a]pyrazin-5-yl)pentan-2-one |
| SMILES | CCCC(=O)Cc1cncc2nnnn12 |
| InChI | InChI=1S/C9H11N5O/c1-2-3-8(15)4-7-5-10-6-9-11-12-13-14(7)9/h5-6H,2-4H2,1H3 |
| InChIKey | XLZSBQBYUNGYEX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 73.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(tetrazolo[1,5-a]pyrazin-5-yl)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(tetrazolo[1,5-a]pyrazin-5-yl)pentan-2-one?
The IUPAC name of 1-(tetrazolo[1,5-a]pyrazin-5-yl)pentan-2-one (CID 63199240) is 1-(tetrazolo[1,5-a]pyrazin-5-yl)pentan-2-one.
What is the SMILES notation for 1-(tetrazolo[1,5-a]pyrazin-5-yl)pentan-2-one?
The canonical SMILES for 1-(tetrazolo[1,5-a]pyrazin-5-yl)pentan-2-one is CCCC(=O)Cc1cncc2nnnn12.
What is the InChIKey of 1-(tetrazolo[1,5-a]pyrazin-5-yl)pentan-2-one?
The InChIKey is XLZSBQBYUNGYEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O/c1-2-3-8(15)4-7-5-10-6-9-11-12-13-14(7)9/h5-6H,2-4H2,1H3.
What are the key properties of 1-(tetrazolo[1,5-a]pyrazin-5-yl)pentan-2-one?
1-(tetrazolo[1,5-a]pyrazin-5-yl)pentan-2-one has a molecular weight of 205.22 g/mol, XLogP of 0.43, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(tetrazolo[1,5-a]pyrazin-5-yl)pentan-2-one is sourced from PubChem (CID 63199240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).