C15H18N2O3 — CID 63200945
3,3-dimethyl-1-(8-nitroisoquinolin-5-yl)butan-2-ol (PubChem CID 63200945) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3,3-dimethyl-1-(8-nitroisoquinolin-5-yl)butan-2-ol.
| Compound Name | 3,3-dimethyl-1-(8-nitroisoquinolin-5-yl)butan-2-ol |
|---|---|
| PubChem CID | 63200945 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3,3-dimethyl-1-(8-nitroisoquinolin-5-yl)butan-2-ol |
| SMILES | CC(C)(C)C(O)Cc1ccc([N+](=O)[O-])c2cnccc12 |
| InChI | InChI=1S/C15H18N2O3/c1-15(2,3)14(18)8-10-4-5-13(17(19)20)12-9-16-7-6-11(10)12/h4-7,9,14,18H,8H2,1-3H3 |
| InChIKey | QOVHNGLLXDEDGK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|