C11H18N2 — CID 63201914
N-methyl-1-(5-methyl-2-pyridinyl)butan-2-amine (PubChem CID 63201914) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is N-methyl-1-(5-methyl-2-pyridinyl)butan-2-amine.
| Compound Name | N-methyl-1-(5-methyl-2-pyridinyl)butan-2-amine |
|---|---|
| PubChem CID | 63201914 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | N-methyl-1-(5-methyl-2-pyridinyl)butan-2-amine |
| SMILES | CCC(Cc1ccc(C)cn1)NC |
| InChI | InChI=1S/C11H18N2/c1-4-10(12-3)7-11-6-5-9(2)8-13-11/h5-6,8,10,12H,4,7H2,1-3H3 |
| InChIKey | WMWCJYOJBXVKTI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |