C11H18ClN3O2 — CID 63202900
2-(2-chloro-3,3-dimethylbutyl)-4,6-dimethoxy-1,3,5-triazine (PubChem CID 63202900) has the molecular formula C11H18ClN3O2 and a molecular weight of 259.74 g/mol. Its IUPAC name is 2-(2-chloro-3,3-dimethylbutyl)-4,6-dimethoxy-1,3,5-triazine.
| Compound Name | 2-(2-chloro-3,3-dimethylbutyl)-4,6-dimethoxy-1,3,5-triazine |
|---|---|
| PubChem CID | 63202900 |
| Molecular Formula | C11H18ClN3O2 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-(2-chloro-3,3-dimethylbutyl)-4,6-dimethoxy-1,3,5-triazine |
| SMILES | COc1nc(CC(Cl)C(C)(C)C)nc(OC)n1 |
| InChI | InChI=1S/C11H18ClN3O2/c1-11(2,3)7(12)6-8-13-9(16-4)15-10(14-8)17-5/h7H,6H2,1-5H3 |
| InChIKey | JBGWENJXUBSMAS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|