C11H14BrN3 — CID 63203897
5-(2-bromobutyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 63203897) has the molecular formula C11H14BrN3 and a molecular weight of 268.16 g/mol. Its IUPAC name is 5-(2-bromobutyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-(2-bromobutyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 63203897 |
| Molecular Formula | C11H14BrN3 |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 5-(2-bromobutyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CCC(Br)Cc1cc(C)cc2ncnn12 |
| InChI | InChI=1S/C11H14BrN3/c1-3-9(12)6-10-4-8(2)5-11-13-7-14-15(10)11/h4-5,7,9H,3,6H2,1-2H3 |
| InChIKey | IWGAZSVTZSRXCS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|