C14H17NO3 — CID 63204186
N-(furan-3-ylmethyl)-3-(2-methoxyethoxy)aniline (PubChem CID 63204186) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-3-(2-methoxyethoxy)aniline.
| Compound Name | N-(furan-3-ylmethyl)-3-(2-methoxyethoxy)aniline |
|---|---|
| PubChem CID | 63204186 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-(furan-3-ylmethyl)-3-(2-methoxyethoxy)aniline |
| SMILES | COCCOc1cccc(NCc2ccoc2)c1 |
| InChI | InChI=1S/C14H17NO3/c1-16-7-8-18-14-4-2-3-13(9-14)15-10-12-5-6-17-11-12/h2-6,9,11,15H,7-8,10H2,1H3 |
| InChIKey | OFXAGZJQTOMTDU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|