About N-(furan-3-ylmethyl)-3,4-dimethylaniline
N-(furan-3-ylmethyl)-3,4-dimethylaniline (PubChem CID 63204332) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-3,4-dimethylaniline.
Molecular Properties
| Compound Name | N-(furan-3-ylmethyl)-3,4-dimethylaniline |
| PubChem CID | 63204332 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | N-(furan-3-ylmethyl)-3,4-dimethylaniline |
| SMILES | Cc1ccc(NCc2ccoc2)cc1C |
| InChI | InChI=1S/C13H15NO/c1-10-3-4-13(7-11(10)2)14-8-12-5-6-15-9-12/h3-7,9,14H,8H2,1-2H3 |
| InChIKey | WDSLMQDVNJPQMJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(furan-3-ylmethyl)-3,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-3-ylmethyl)-3,4-dimethylaniline?
The IUPAC name of N-(furan-3-ylmethyl)-3,4-dimethylaniline (CID 63204332) is N-(furan-3-ylmethyl)-3,4-dimethylaniline.
What is the SMILES notation for N-(furan-3-ylmethyl)-3,4-dimethylaniline?
The canonical SMILES for N-(furan-3-ylmethyl)-3,4-dimethylaniline is Cc1ccc(NCc2ccoc2)cc1C.
What is the InChIKey of N-(furan-3-ylmethyl)-3,4-dimethylaniline?
The InChIKey is WDSLMQDVNJPQMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO/c1-10-3-4-13(7-11(10)2)14-8-12-5-6-15-9-12/h3-7,9,14H,8H2,1-2H3.
What are the key properties of N-(furan-3-ylmethyl)-3,4-dimethylaniline?
N-(furan-3-ylmethyl)-3,4-dimethylaniline has a molecular weight of 201.27 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-3-ylmethyl)-3,4-dimethylaniline is sourced from PubChem (CID 63204332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).