About 2-(2-chloro-4-methylpentan-3-yl)-4,6-dimethoxy-1,3,5-triazine
2-(2-chloro-4-methylpentan-3-yl)-4,6-dimethoxy-1,3,5-triazine (PubChem CID 63205061) has the molecular formula C11H18ClN3O2
and a molecular weight of 259.74 g/mol. Its IUPAC name is 2-(2-chloro-4-methylpentan-3-yl)-4,6-dimethoxy-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-(2-chloro-4-methylpentan-3-yl)-4,6-dimethoxy-1,3,5-triazine |
| PubChem CID | 63205061 |
| Molecular Formula | C11H18ClN3O2 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-(2-chloro-4-methylpentan-3-yl)-4,6-dimethoxy-1,3,5-triazine |
| SMILES | COc1nc(OC)nc(C(C(C)C)C(C)Cl)n1 |
| InChI | InChI=1S/C11H18ClN3O2/c1-6(2)8(7(3)12)9-13-10(16-4)15-11(14-9)17-5/h6-8H,1-5H3 |
| InChIKey | IWBDCYXICNGJJI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloro-4-methylpentan-3-yl)-4,6-dimethoxy-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-4-methylpentan-3-yl)-4,6-dimethoxy-1,3,5-triazine?
The IUPAC name of 2-(2-chloro-4-methylpentan-3-yl)-4,6-dimethoxy-1,3,5-triazine (CID 63205061) is 2-(2-chloro-4-methylpentan-3-yl)-4,6-dimethoxy-1,3,5-triazine.
What is the SMILES notation for 2-(2-chloro-4-methylpentan-3-yl)-4,6-dimethoxy-1,3,5-triazine?
The canonical SMILES for 2-(2-chloro-4-methylpentan-3-yl)-4,6-dimethoxy-1,3,5-triazine is COc1nc(OC)nc(C(C(C)C)C(C)Cl)n1.
What is the InChIKey of 2-(2-chloro-4-methylpentan-3-yl)-4,6-dimethoxy-1,3,5-triazine?
The InChIKey is IWBDCYXICNGJJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClN3O2/c1-6(2)8(7(3)12)9-13-10(16-4)15-11(14-9)17-5/h6-8H,1-5H3.
What are the key properties of 2-(2-chloro-4-methylpentan-3-yl)-4,6-dimethoxy-1,3,5-triazine?
2-(2-chloro-4-methylpentan-3-yl)-4,6-dimethoxy-1,3,5-triazine has a molecular weight of 259.74 g/mol, XLogP of 2.26, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-4-methylpentan-3-yl)-4,6-dimethoxy-1,3,5-triazine is sourced from PubChem (CID 63205061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).