About 4-[(3,5-dimethylphenyl)methyl]-5-ethyl-6-methyl-3-pyrrol-1-yl-1H-pyridin-2-one
4-[(3,5-dimethylphenyl)methyl]-5-ethyl-6-methyl-3-pyrrol-1-yl-1H-pyridin-2-one (PubChem CID 6320552) has the molecular formula C21H24N2O
and a molecular weight of 320.44 g/mol. Its IUPAC name is 4-[(3,5-dimethylphenyl)methyl]-5-ethyl-6-methyl-3-pyrrol-1-yl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-[(3,5-dimethylphenyl)methyl]-5-ethyl-6-methyl-3-pyrrol-1-yl-1H-pyridin-2-one |
| PubChem CID | 6320552 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 4-[(3,5-dimethylphenyl)methyl]-5-ethyl-6-methyl-3-pyrrol-1-yl-1H-pyridin-2-one |
| SMILES | CCc1c(C)[nH]c(=O)c(-n2cccc2)c1Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C21H24N2O/c1-5-18-16(4)22-21(24)20(23-8-6-7-9-23)19(18)13-17-11-14(2)10-15(3)12-17/h6-12H,5,13H2,1-4H3,(H,22,24) |
| InChIKey | PURFEOGTUNSLNC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(3,5-dimethylphenyl)methyl]-5-ethyl-6-methyl-3-pyrrol-1-yl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-dimethylphenyl)methyl]-5-ethyl-6-methyl-3-pyrrol-1-yl-1H-pyridin-2-one?
The IUPAC name of 4-[(3,5-dimethylphenyl)methyl]-5-ethyl-6-methyl-3-pyrrol-1-yl-1H-pyridin-2-one (CID 6320552) is 4-[(3,5-dimethylphenyl)methyl]-5-ethyl-6-methyl-3-pyrrol-1-yl-1H-pyridin-2-one.
What is the SMILES notation for 4-[(3,5-dimethylphenyl)methyl]-5-ethyl-6-methyl-3-pyrrol-1-yl-1H-pyridin-2-one?
The canonical SMILES for 4-[(3,5-dimethylphenyl)methyl]-5-ethyl-6-methyl-3-pyrrol-1-yl-1H-pyridin-2-one is CCc1c(C)[nH]c(=O)c(-n2cccc2)c1Cc1cc(C)cc(C)c1.
What is the InChIKey of 4-[(3,5-dimethylphenyl)methyl]-5-ethyl-6-methyl-3-pyrrol-1-yl-1H-pyridin-2-one?
The InChIKey is PURFEOGTUNSLNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O/c1-5-18-16(4)22-21(24)20(23-8-6-7-9-23)19(18)13-17-11-14(2)10-15(3)12-17/h6-12H,5,13H2,1-4H3,(H,22,24).
What are the key properties of 4-[(3,5-dimethylphenyl)methyl]-5-ethyl-6-methyl-3-pyrrol-1-yl-1H-pyridin-2-one?
4-[(3,5-dimethylphenyl)methyl]-5-ethyl-6-methyl-3-pyrrol-1-yl-1H-pyridin-2-one has a molecular weight of 320.44 g/mol, XLogP of 4.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-dimethylphenyl)methyl]-5-ethyl-6-methyl-3-pyrrol-1-yl-1H-pyridin-2-one is sourced from PubChem (CID 6320552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).