C11H19N3 — CID 63205925
N,3-dimethyl-1-(5-methylpyrimidin-2-yl)butan-2-amine (PubChem CID 63205925) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N,3-dimethyl-1-(5-methylpyrimidin-2-yl)butan-2-amine.
| Compound Name | N,3-dimethyl-1-(5-methylpyrimidin-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 63205925 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N,3-dimethyl-1-(5-methylpyrimidin-2-yl)butan-2-amine |
| SMILES | CNC(Cc1ncc(C)cn1)C(C)C |
| InChI | InChI=1S/C11H19N3/c1-8(2)10(12-4)5-11-13-6-9(3)7-14-11/h6-8,10,12H,5H2,1-4H3 |
| InChIKey | BZEMWRATDSDGMJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |