C15H11ClN6OS2 — CID 6320732
11-amino-9-(4-chlorophenyl)-5,13-bis(sulfanylidene)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(14),3(8),10-trien-7-one (PubChem CID 6320732) has the molecular formula C15H11ClN6OS2 and a molecular weight of 390.88 g/mol. Its IUPAC name is 11-amino-9-(4-chlorophenyl)-5,13-bis(sulfanylidene)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(14),3(8),10-trien-7-one.
| Compound Name | 11-amino-9-(4-chlorophenyl)-5,13-bis(sulfanylidene)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(14),3(8),10-trien-7-one |
|---|---|
| PubChem CID | 6320732 |
| Molecular Formula | C15H11ClN6OS2 |
| Molecular Weight | 390.88 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 11-amino-9-(4-chlorophenyl)-5,13-bis(sulfanylidene)-2,4,6,12,14-pentazatricyclo[8.4.0.03,8]tetradeca-1(14),3(8),10-trien-7-one |
| SMILES | Nc1[nH]c(=S)nc2c1C(c1ccc(Cl)cc1)c1c([nH]c(=S)[nH]c1=O)N2 |
| InChI | InChI=1S/C15H11ClN6OS2/c16-6-3-1-5(2-4-6)7-8-10(17)18-14(24)20-11(8)19-12-9(7)13(23)22-15(25)21-12/h1-4,7H,(H6,17,18,19,20,21,22,23,24,25) |
| InChIKey | YHHPKHDMALXOMB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.88 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|