C15H28N2O3 — CID 63207711
2-methyl-4-[methyl(2-pyrrolidin-1-ylethyl)amino]-4-oxo-2-propan-2-ylbutanoic acid (PubChem CID 63207711) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is 2-methyl-4-[methyl(2-pyrrolidin-1-ylethyl)amino]-4-oxo-2-propan-2-ylbutanoic acid.
| Compound Name | 2-methyl-4-[methyl(2-pyrrolidin-1-ylethyl)amino]-4-oxo-2-propan-2-ylbutanoic acid |
|---|---|
| PubChem CID | 63207711 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 2-methyl-4-[methyl(2-pyrrolidin-1-ylethyl)amino]-4-oxo-2-propan-2-ylbutanoic acid |
| SMILES | CC(C)C(C)(CC(=O)N(C)CCN1CCCC1)C(=O)O |
| InChI | InChI=1S/C15H28N2O3/c1-12(2)15(3,14(19)20)11-13(18)16(4)9-10-17-7-5-6-8-17/h12H,5-11H2,1-4H3,(H,19,20) |
| InChIKey | MNSPAEGQGANLKC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |