C14H19FN2O2 — CID 63207861
5-fluoro-2-[methyl(2-pyrrolidin-1-ylethyl)amino]benzoic acid (PubChem CID 63207861) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 5-fluoro-2-[methyl(2-pyrrolidin-1-ylethyl)amino]benzoic acid.
| Compound Name | 5-fluoro-2-[methyl(2-pyrrolidin-1-ylethyl)amino]benzoic acid |
|---|---|
| PubChem CID | 63207861 |
| Molecular Formula | C14H19FN2O2 |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 5-fluoro-2-[methyl(2-pyrrolidin-1-ylethyl)amino]benzoic acid |
| SMILES | CN(CCN1CCCC1)c1ccc(F)cc1C(=O)O |
| InChI | InChI=1S/C14H19FN2O2/c1-16(8-9-17-6-2-3-7-17)13-5-4-11(15)10-12(13)14(18)19/h4-5,10H,2-3,6-9H2,1H3,(H,18,19) |
| InChIKey | HGTBMXLZAKLQBN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |