C15H33N3O — CID 63208969
N-(4-ethoxybutyl)-N'-methyl-N'-(2-pyrrolidin-1-ylethyl)ethane-1,2-diamine (PubChem CID 63208969) has the molecular formula C15H33N3O and a molecular weight of 271.45 g/mol. Its IUPAC name is N-(4-ethoxybutyl)-N'-methyl-N'-(2-pyrrolidin-1-ylethyl)ethane-1,2-diamine.
| Compound Name | N-(4-ethoxybutyl)-N'-methyl-N'-(2-pyrrolidin-1-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 63208969 |
| Molecular Formula | C15H33N3O |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.26 |
| IUPAC Name | N-(4-ethoxybutyl)-N'-methyl-N'-(2-pyrrolidin-1-ylethyl)ethane-1,2-diamine |
| SMILES | CCOCCCCNCCN(C)CCN1CCCC1 |
| InChI | InChI=1S/C15H33N3O/c1-3-19-15-7-4-8-16-9-12-17(2)13-14-18-10-5-6-11-18/h16H,3-15H2,1-2H3 |
| InChIKey | LKQZZFOTDQGNEI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|