2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid

C14H18FNO3 — CID 63209855

IUPAC2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid
SMILESCc1cc(C(=O)NC(C(=O)O)C(C)(C)C)ccc1F
InChIInChI=1S/C14H18FNO3/c1-8-7-9(5-6-10(8)15)12(17)16-11(13(18)19)14(2,3)4/h5-7,11H,1-4H3,(H,16,17)(H,18,19)
InChIKeyUVVPKKWUKJHDSX-UHFFFAOYSA-N
MW267.30 g/mol
LogP2.36
Rot. Bonds3

About 2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid

2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid (PubChem CID 63209855) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is 2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid.

Molecular Properties

Compound Name2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid
PubChem CID63209855
Molecular FormulaC14H18FNO3
Molecular Weight267.30 g/mol
Exact Mass267.13
IUPAC Name2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid
SMILESCc1cc(C(=O)NC(C(=O)O)C(C)(C)C)ccc1F
InChIInChI=1S/C14H18FNO3/c1-8-7-9(5-6-10(8)15)12(17)16-11(13(18)19)14(2,3)4/h5-7,11H,1-4H3,(H,16,17)(H,18,19)
InChIKeyUVVPKKWUKJHDSX-UHFFFAOYSA-N
XLogP2.36
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.30
LogP ≤ 52.36
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid?
The IUPAC name of 2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid (CID 63209855) is 2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid.
What is the SMILES notation for 2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid?
The canonical SMILES for 2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid is Cc1cc(C(=O)NC(C(=O)O)C(C)(C)C)ccc1F.
What is the InChIKey of 2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid?
The InChIKey is UVVPKKWUKJHDSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO3/c1-8-7-9(5-6-10(8)15)12(17)16-11(13(18)19)14(2,3)4/h5-7,11H,1-4H3,(H,16,17)(H,18,19).
What are the key properties of 2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid?
2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid has a molecular weight of 267.30 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-fluoro-3-methylbenzoyl)amino]-3,3-dimethylbutanoic acid is sourced from PubChem (CID 63209855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).