C10H11FN2OS — CID 63210073
N-(2-amino-2-sulfanylideneethyl)-4-fluoro-3-methylbenzamide (PubChem CID 63210073) has the molecular formula C10H11FN2OS and a molecular weight of 226.28 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-4-fluoro-3-methylbenzamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-4-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 63210073 |
| Molecular Formula | C10H11FN2OS |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-4-fluoro-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NCC(N)=S)ccc1F |
| InChI | InChI=1S/C10H11FN2OS/c1-6-4-7(2-3-8(6)11)10(14)13-5-9(12)15/h2-4H,5H2,1H3,(H2,12,15)(H,13,14) |
| InChIKey | MFBAVNZNMRWDAN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|