C12H14FN3 — CID 63210316
4-ethyl-5-(4-fluoro-3-methylphenyl)-1H-pyrazol-3-amine (PubChem CID 63210316) has the molecular formula C12H14FN3 and a molecular weight of 219.26 g/mol. Its IUPAC name is 4-ethyl-5-(4-fluoro-3-methylphenyl)-1H-pyrazol-3-amine.
| Compound Name | 4-ethyl-5-(4-fluoro-3-methylphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 63210316 |
| Molecular Formula | C12H14FN3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 4-ethyl-5-(4-fluoro-3-methylphenyl)-1H-pyrazol-3-amine |
| SMILES | CCc1c(N)n[nH]c1-c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C12H14FN3/c1-3-9-11(15-16-12(9)14)8-4-5-10(13)7(2)6-8/h4-6H,3H2,1-2H3,(H3,14,15,16) |
| InChIKey | ZCWCKNZBZNPQJK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |