About 3-(ethylaminomethyl)-N,4,6-trimethyl-N-(2-pyrrolidin-1-ylethyl)pyridin-2-amine
3-(ethylaminomethyl)-N,4,6-trimethyl-N-(2-pyrrolidin-1-ylethyl)pyridin-2-amine (PubChem CID 63211011) has the molecular formula C17H30N4
and a molecular weight of 290.46 g/mol. Its IUPAC name is 3-(ethylaminomethyl)-N,4,6-trimethyl-N-(2-pyrrolidin-1-ylethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-(ethylaminomethyl)-N,4,6-trimethyl-N-(2-pyrrolidin-1-ylethyl)pyridin-2-amine |
| PubChem CID | 63211011 |
| Molecular Formula | C17H30N4 |
| Molecular Weight | 290.46 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 3-(ethylaminomethyl)-N,4,6-trimethyl-N-(2-pyrrolidin-1-ylethyl)pyridin-2-amine |
| SMILES | CCNCc1c(C)cc(C)nc1N(C)CCN1CCCC1 |
| InChI | InChI=1S/C17H30N4/c1-5-18-13-16-14(2)12-15(3)19-17(16)20(4)10-11-21-8-6-7-9-21/h12,18H,5-11,13H2,1-4H3 |
| InChIKey | CXHCRYQEACGCSS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(ethylaminomethyl)-N,4,6-trimethyl-N-(2-pyrrolidin-1-ylethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylaminomethyl)-N,4,6-trimethyl-N-(2-pyrrolidin-1-ylethyl)pyridin-2-amine?
The IUPAC name of 3-(ethylaminomethyl)-N,4,6-trimethyl-N-(2-pyrrolidin-1-ylethyl)pyridin-2-amine (CID 63211011) is 3-(ethylaminomethyl)-N,4,6-trimethyl-N-(2-pyrrolidin-1-ylethyl)pyridin-2-amine.
What is the SMILES notation for 3-(ethylaminomethyl)-N,4,6-trimethyl-N-(2-pyrrolidin-1-ylethyl)pyridin-2-amine?
The canonical SMILES for 3-(ethylaminomethyl)-N,4,6-trimethyl-N-(2-pyrrolidin-1-ylethyl)pyridin-2-amine is CCNCc1c(C)cc(C)nc1N(C)CCN1CCCC1.
What is the InChIKey of 3-(ethylaminomethyl)-N,4,6-trimethyl-N-(2-pyrrolidin-1-ylethyl)pyridin-2-amine?
The InChIKey is CXHCRYQEACGCSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N4/c1-5-18-13-16-14(2)12-15(3)19-17(16)20(4)10-11-21-8-6-7-9-21/h12,18H,5-11,13H2,1-4H3.
What are the key properties of 3-(ethylaminomethyl)-N,4,6-trimethyl-N-(2-pyrrolidin-1-ylethyl)pyridin-2-amine?
3-(ethylaminomethyl)-N,4,6-trimethyl-N-(2-pyrrolidin-1-ylethyl)pyridin-2-amine has a molecular weight of 290.46 g/mol, XLogP of 2.34, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylaminomethyl)-N,4,6-trimethyl-N-(2-pyrrolidin-1-ylethyl)pyridin-2-amine is sourced from PubChem (CID 63211011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).