C15H16FN3O — CID 63211664
N-(3-fluorophenyl)-4-hydrazinyl-N,3-dimethylbenzamide (PubChem CID 63211664) has the molecular formula C15H16FN3O and a molecular weight of 273.31 g/mol. Its IUPAC name is N-(3-fluorophenyl)-4-hydrazinyl-N,3-dimethylbenzamide.
| Compound Name | N-(3-fluorophenyl)-4-hydrazinyl-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 63211664 |
| Molecular Formula | C15H16FN3O |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-(3-fluorophenyl)-4-hydrazinyl-N,3-dimethylbenzamide |
| SMILES | Cc1cc(C(=O)N(C)c2cccc(F)c2)ccc1NN |
| InChI | InChI=1S/C15H16FN3O/c1-10-8-11(6-7-14(10)18-17)15(20)19(2)13-5-3-4-12(16)9-13/h3-9,18H,17H2,1-2H3 |
| InChIKey | DCEJBHDTGMHXHJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|