C15H16ClN3O — CID 63211678
N-[(4-chlorophenyl)methyl]-4-hydrazinyl-3-methylbenzamide (PubChem CID 63211678) has the molecular formula C15H16ClN3O and a molecular weight of 289.77 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-hydrazinyl-3-methylbenzamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-hydrazinyl-3-methylbenzamide |
|---|---|
| PubChem CID | 63211678 |
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-hydrazinyl-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NCc2ccc(Cl)cc2)ccc1NN |
| InChI | InChI=1S/C15H16ClN3O/c1-10-8-12(4-7-14(10)19-17)15(20)18-9-11-2-5-13(16)6-3-11/h2-8,19H,9,17H2,1H3,(H,18,20) |
| InChIKey | ZWBRFIBTWAZEOV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|