C16H16FNO3 — CID 63212434
N-(3,4-dimethoxyphenyl)-4-fluoro-3-methylbenzamide (PubChem CID 63212434) has the molecular formula C16H16FNO3 and a molecular weight of 289.31 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-fluoro-3-methylbenzamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-4-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 63212434 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-fluoro-3-methylbenzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(F)c(C)c2)cc1OC |
| InChI | InChI=1S/C16H16FNO3/c1-10-8-11(4-6-13(10)17)16(19)18-12-5-7-14(20-2)15(9-12)21-3/h4-9H,1-3H3,(H,18,19) |
| InChIKey | ALOYEXBLVGHJRN-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |