About (1S)-N,N-dimethyl-1,2-diphenylethanamine
(1S)-N,N-dimethyl-1,2-diphenylethanamine (PubChem CID 6321252) has the molecular formula C16H19N
and a molecular weight of 225.34 g/mol. Its IUPAC name is (1S)-N,N-dimethyl-1,2-diphenylethanamine.
Molecular Properties
| Compound Name | (1S)-N,N-dimethyl-1,2-diphenylethanamine |
| PubChem CID | 6321252 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (1S)-N,N-dimethyl-1,2-diphenylethanamine |
| SMILES | CN(C)[C@@H](Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H19N/c1-17(2)16(15-11-7-4-8-12-15)13-14-9-5-3-6-10-14/h3-12,16H,13H2,1-2H3/t16-/m0/s1 |
| InChIKey | YEJZJVJJPVZXGX-INIZCTEOSA-N |
| XLogP | 3.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-N,N-dimethyl-1,2-diphenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N,N-dimethyl-1,2-diphenylethanamine?
The IUPAC name of (1S)-N,N-dimethyl-1,2-diphenylethanamine (CID 6321252) is (1S)-N,N-dimethyl-1,2-diphenylethanamine.
What is the SMILES notation for (1S)-N,N-dimethyl-1,2-diphenylethanamine?
The canonical SMILES for (1S)-N,N-dimethyl-1,2-diphenylethanamine is CN(C)[C@@H](Cc1ccccc1)c1ccccc1.
What is the InChIKey of (1S)-N,N-dimethyl-1,2-diphenylethanamine?
The InChIKey is YEJZJVJJPVZXGX-INIZCTEOSA-N. The full InChI is InChI=1S/C16H19N/c1-17(2)16(15-11-7-4-8-12-15)13-14-9-5-3-6-10-14/h3-12,16H,13H2,1-2H3/t16-/m0/s1.
What are the key properties of (1S)-N,N-dimethyl-1,2-diphenylethanamine?
(1S)-N,N-dimethyl-1,2-diphenylethanamine has a molecular weight of 225.34 g/mol, XLogP of 3.53, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N,N-dimethyl-1,2-diphenylethanamine is sourced from PubChem (CID 6321252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).