About 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one
2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one (PubChem CID 632135) has the molecular formula C20H20O7
and a molecular weight of 372.37 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one |
| PubChem CID | 632135 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)cc(OC)c(OC)c3o2)cc1OC |
| InChI | InChI=1S/C20H20O7/c1-22-13-7-6-11(8-15(13)23-2)14-9-12(21)18-16(24-3)10-17(25-4)19(26-5)20(18)27-14/h6-10H,1-5H3 |
| InChIKey | UYCWETIUOAGWIL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one (CID 632135) is 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one is COc1ccc(-c2cc(=O)c3c(OC)cc(OC)c(OC)c3o2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one?
The InChIKey is UYCWETIUOAGWIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O7/c1-22-13-7-6-11(8-15(13)23-2)14-9-12(21)18-16(24-3)10-17(25-4)19(26-5)20(18)27-14/h6-10H,1-5H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one?
2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one has a molecular weight of 372.37 g/mol, XLogP of 3.50, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-5,7,8-trimethoxychromen-4-one is sourced from PubChem (CID 632135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).