About (8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-pyrazin-2-ylmethanone
(8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-pyrazin-2-ylmethanone (PubChem CID 63215592) has the molecular formula C14H13N3O2
and a molecular weight of 255.28 g/mol. Its IUPAC name is (8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-pyrazin-2-ylmethanone.
Molecular Properties
| Compound Name | (8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-pyrazin-2-ylmethanone |
| PubChem CID | 63215592 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-pyrazin-2-ylmethanone |
| SMILES | O=C(c1cnccn1)N1CCCc2cccc(O)c21 |
| InChI | InChI=1S/C14H13N3O2/c18-12-5-1-3-10-4-2-8-17(13(10)12)14(19)11-9-15-6-7-16-11/h1,3,5-7,9,18H,2,4,8H2 |
| InChIKey | RSPLTPLUGHDASQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-pyrazin-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-pyrazin-2-ylmethanone?
The IUPAC name of (8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-pyrazin-2-ylmethanone (CID 63215592) is (8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-pyrazin-2-ylmethanone.
What is the SMILES notation for (8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-pyrazin-2-ylmethanone?
The canonical SMILES for (8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-pyrazin-2-ylmethanone is O=C(c1cnccn1)N1CCCc2cccc(O)c21.
What is the InChIKey of (8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-pyrazin-2-ylmethanone?
The InChIKey is RSPLTPLUGHDASQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2/c18-12-5-1-3-10-4-2-8-17(13(10)12)14(19)11-9-15-6-7-16-11/h1,3,5-7,9,18H,2,4,8H2.
What are the key properties of (8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-pyrazin-2-ylmethanone?
(8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-pyrazin-2-ylmethanone has a molecular weight of 255.28 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8-hydroxy-3,4-dihydro-2H-quinolin-1-yl)-pyrazin-2-ylmethanone is sourced from PubChem (CID 63215592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).