About 4-chloro-3-[(2,2-dimethylpyrrolidin-1-yl)methyl]aniline
4-chloro-3-[(2,2-dimethylpyrrolidin-1-yl)methyl]aniline (PubChem CID 63215901) has the molecular formula C13H19ClN2
and a molecular weight of 238.76 g/mol. Its IUPAC name is 4-chloro-3-[(2,2-dimethylpyrrolidin-1-yl)methyl]aniline.
Molecular Properties
| Compound Name | 4-chloro-3-[(2,2-dimethylpyrrolidin-1-yl)methyl]aniline |
| PubChem CID | 63215901 |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-chloro-3-[(2,2-dimethylpyrrolidin-1-yl)methyl]aniline |
| SMILES | CC1(C)CCCN1Cc1cc(N)ccc1Cl |
| InChI | InChI=1S/C13H19ClN2/c1-13(2)6-3-7-16(13)9-10-8-11(15)4-5-12(10)14/h4-5,8H,3,6-7,9,15H2,1-2H3 |
| InChIKey | ICVJXIOAYKPUDE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-[(2,2-dimethylpyrrolidin-1-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-[(2,2-dimethylpyrrolidin-1-yl)methyl]aniline?
The IUPAC name of 4-chloro-3-[(2,2-dimethylpyrrolidin-1-yl)methyl]aniline (CID 63215901) is 4-chloro-3-[(2,2-dimethylpyrrolidin-1-yl)methyl]aniline.
What is the SMILES notation for 4-chloro-3-[(2,2-dimethylpyrrolidin-1-yl)methyl]aniline?
The canonical SMILES for 4-chloro-3-[(2,2-dimethylpyrrolidin-1-yl)methyl]aniline is CC1(C)CCCN1Cc1cc(N)ccc1Cl.
What is the InChIKey of 4-chloro-3-[(2,2-dimethylpyrrolidin-1-yl)methyl]aniline?
The InChIKey is ICVJXIOAYKPUDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClN2/c1-13(2)6-3-7-16(13)9-10-8-11(15)4-5-12(10)14/h4-5,8H,3,6-7,9,15H2,1-2H3.
What are the key properties of 4-chloro-3-[(2,2-dimethylpyrrolidin-1-yl)methyl]aniline?
4-chloro-3-[(2,2-dimethylpyrrolidin-1-yl)methyl]aniline has a molecular weight of 238.76 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-[(2,2-dimethylpyrrolidin-1-yl)methyl]aniline is sourced from PubChem (CID 63215901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).