C17H21BrN2O — CID 63216590
N-[[6-(4-bromo-2-methylphenoxy)-3-pyridinyl]methyl]-2-methylpropan-2-amine (PubChem CID 63216590) has the molecular formula C17H21BrN2O and a molecular weight of 349.27 g/mol. Its IUPAC name is N-[[6-(4-bromo-2-methylphenoxy)-3-pyridinyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[6-(4-bromo-2-methylphenoxy)-3-pyridinyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 63216590 |
| Molecular Formula | C17H21BrN2O |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | N-[[6-(4-bromo-2-methylphenoxy)-3-pyridinyl]methyl]-2-methylpropan-2-amine |
| SMILES | Cc1cc(Br)ccc1Oc1ccc(CNC(C)(C)C)cn1 |
| InChI | InChI=1S/C17H21BrN2O/c1-12-9-14(18)6-7-15(12)21-16-8-5-13(10-19-16)11-20-17(2,3)4/h5-10,20H,11H2,1-4H3 |
| InChIKey | FATDXZROPPCZKS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |