C18H25NO2 — CID 63217419
4-[4-[2-(2,2-dimethylpyrrolidin-1-yl)ethoxy]phenyl]but-3-yn-1-ol (PubChem CID 63217419) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 4-[4-[2-(2,2-dimethylpyrrolidin-1-yl)ethoxy]phenyl]but-3-yn-1-ol.
| Compound Name | 4-[4-[2-(2,2-dimethylpyrrolidin-1-yl)ethoxy]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 63217419 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 4-[4-[2-(2,2-dimethylpyrrolidin-1-yl)ethoxy]phenyl]but-3-yn-1-ol |
| SMILES | CC1(C)CCCN1CCOc1ccc(C#CCCO)cc1 |
| InChI | InChI=1S/C18H25NO2/c1-18(2)11-5-12-19(18)13-15-21-17-9-7-16(8-10-17)6-3-4-14-20/h7-10,20H,4-5,11-15H2,1-2H3 |
| InChIKey | SATCRNMNLUAPFU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|