C13H16ClNO3S — CID 63217868
3-(2,2-dimethylpyrrolidine-1-carbonyl)benzenesulfonyl chloride (PubChem CID 63217868) has the molecular formula C13H16ClNO3S and a molecular weight of 301.79 g/mol. Its IUPAC name is 3-(2,2-dimethylpyrrolidine-1-carbonyl)benzenesulfonyl chloride.
| Compound Name | 3-(2,2-dimethylpyrrolidine-1-carbonyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 63217868 |
| Molecular Formula | C13H16ClNO3S |
| Molecular Weight | 301.79 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 3-(2,2-dimethylpyrrolidine-1-carbonyl)benzenesulfonyl chloride |
| SMILES | CC1(C)CCCN1C(=O)c1cccc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C13H16ClNO3S/c1-13(2)7-4-8-15(13)12(16)10-5-3-6-11(9-10)19(14,17)18/h3,5-6,9H,4,7-8H2,1-2H3 |
| InChIKey | SUMMPSGVFDEQJO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.79 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |