About [1-(3-phenylpropyl)-3,4-dihydro-2H-quinolin-2-yl]methanamine
[1-(3-phenylpropyl)-3,4-dihydro-2H-quinolin-2-yl]methanamine (PubChem CID 63218760) has the molecular formula C19H24N2
and a molecular weight of 280.42 g/mol. Its IUPAC name is [1-(3-phenylpropyl)-3,4-dihydro-2H-quinolin-2-yl]methanamine.
Molecular Properties
| Compound Name | [1-(3-phenylpropyl)-3,4-dihydro-2H-quinolin-2-yl]methanamine |
| PubChem CID | 63218760 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | [1-(3-phenylpropyl)-3,4-dihydro-2H-quinolin-2-yl]methanamine |
| SMILES | NCC1CCc2ccccc2N1CCCc1ccccc1 |
| InChI | InChI=1S/C19H24N2/c20-15-18-13-12-17-10-4-5-11-19(17)21(18)14-6-9-16-7-2-1-3-8-16/h1-5,7-8,10-11,18H,6,9,12-15,20H2 |
| InChIKey | KQWOFGIPBBWXDM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(3-phenylpropyl)-3,4-dihydro-2H-quinolin-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3-phenylpropyl)-3,4-dihydro-2H-quinolin-2-yl]methanamine?
The IUPAC name of [1-(3-phenylpropyl)-3,4-dihydro-2H-quinolin-2-yl]methanamine (CID 63218760) is [1-(3-phenylpropyl)-3,4-dihydro-2H-quinolin-2-yl]methanamine.
What is the SMILES notation for [1-(3-phenylpropyl)-3,4-dihydro-2H-quinolin-2-yl]methanamine?
The canonical SMILES for [1-(3-phenylpropyl)-3,4-dihydro-2H-quinolin-2-yl]methanamine is NCC1CCc2ccccc2N1CCCc1ccccc1.
What is the InChIKey of [1-(3-phenylpropyl)-3,4-dihydro-2H-quinolin-2-yl]methanamine?
The InChIKey is KQWOFGIPBBWXDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2/c20-15-18-13-12-17-10-4-5-11-19(17)21(18)14-6-9-16-7-2-1-3-8-16/h1-5,7-8,10-11,18H,6,9,12-15,20H2.
What are the key properties of [1-(3-phenylpropyl)-3,4-dihydro-2H-quinolin-2-yl]methanamine?
[1-(3-phenylpropyl)-3,4-dihydro-2H-quinolin-2-yl]methanamine has a molecular weight of 280.42 g/mol, XLogP of 3.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3-phenylpropyl)-3,4-dihydro-2H-quinolin-2-yl]methanamine is sourced from PubChem (CID 63218760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).