About 2-amino-5-(2,2-dimethylpyrrolidin-1-yl)-4-fluorobenzoic acid
2-amino-5-(2,2-dimethylpyrrolidin-1-yl)-4-fluorobenzoic acid (PubChem CID 63219128) has the molecular formula C13H17FN2O2
and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-amino-5-(2,2-dimethylpyrrolidin-1-yl)-4-fluorobenzoic acid.
Molecular Properties
| Compound Name | 2-amino-5-(2,2-dimethylpyrrolidin-1-yl)-4-fluorobenzoic acid |
| PubChem CID | 63219128 |
| Molecular Formula | C13H17FN2O2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-amino-5-(2,2-dimethylpyrrolidin-1-yl)-4-fluorobenzoic acid |
| SMILES | CC1(C)CCCN1c1cc(C(=O)O)c(N)cc1F |
| InChI | InChI=1S/C13H17FN2O2/c1-13(2)4-3-5-16(13)11-6-8(12(17)18)10(15)7-9(11)14/h6-7H,3-5,15H2,1-2H3,(H,17,18) |
| InChIKey | YLOAYICPTICUNC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-(2,2-dimethylpyrrolidin-1-yl)-4-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-(2,2-dimethylpyrrolidin-1-yl)-4-fluorobenzoic acid?
The IUPAC name of 2-amino-5-(2,2-dimethylpyrrolidin-1-yl)-4-fluorobenzoic acid (CID 63219128) is 2-amino-5-(2,2-dimethylpyrrolidin-1-yl)-4-fluorobenzoic acid.
What is the SMILES notation for 2-amino-5-(2,2-dimethylpyrrolidin-1-yl)-4-fluorobenzoic acid?
The canonical SMILES for 2-amino-5-(2,2-dimethylpyrrolidin-1-yl)-4-fluorobenzoic acid is CC1(C)CCCN1c1cc(C(=O)O)c(N)cc1F.
What is the InChIKey of 2-amino-5-(2,2-dimethylpyrrolidin-1-yl)-4-fluorobenzoic acid?
The InChIKey is YLOAYICPTICUNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FN2O2/c1-13(2)4-3-5-16(13)11-6-8(12(17)18)10(15)7-9(11)14/h6-7H,3-5,15H2,1-2H3,(H,17,18).
What are the key properties of 2-amino-5-(2,2-dimethylpyrrolidin-1-yl)-4-fluorobenzoic acid?
2-amino-5-(2,2-dimethylpyrrolidin-1-yl)-4-fluorobenzoic acid has a molecular weight of 252.29 g/mol, XLogP of 2.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-(2,2-dimethylpyrrolidin-1-yl)-4-fluorobenzoic acid is sourced from PubChem (CID 63219128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).