About 1-[4-(chloromethyl)-2,6-difluorophenyl]-2,2-dimethylpyrrolidine
1-[4-(chloromethyl)-2,6-difluorophenyl]-2,2-dimethylpyrrolidine (PubChem CID 63219563) has the molecular formula C13H16ClF2N
and a molecular weight of 259.73 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-2,6-difluorophenyl]-2,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 1-[4-(chloromethyl)-2,6-difluorophenyl]-2,2-dimethylpyrrolidine |
| PubChem CID | 63219563 |
| Molecular Formula | C13H16ClF2N |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 1-[4-(chloromethyl)-2,6-difluorophenyl]-2,2-dimethylpyrrolidine |
| SMILES | CC1(C)CCCN1c1c(F)cc(CCl)cc1F |
| InChI | InChI=1S/C13H16ClF2N/c1-13(2)4-3-5-17(13)12-10(15)6-9(8-14)7-11(12)16/h6-7H,3-5,8H2,1-2H3 |
| InChIKey | JNPUMAMUOHEZRP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(chloromethyl)-2,6-difluorophenyl]-2,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(chloromethyl)-2,6-difluorophenyl]-2,2-dimethylpyrrolidine?
The IUPAC name of 1-[4-(chloromethyl)-2,6-difluorophenyl]-2,2-dimethylpyrrolidine (CID 63219563) is 1-[4-(chloromethyl)-2,6-difluorophenyl]-2,2-dimethylpyrrolidine.
What is the SMILES notation for 1-[4-(chloromethyl)-2,6-difluorophenyl]-2,2-dimethylpyrrolidine?
The canonical SMILES for 1-[4-(chloromethyl)-2,6-difluorophenyl]-2,2-dimethylpyrrolidine is CC1(C)CCCN1c1c(F)cc(CCl)cc1F.
What is the InChIKey of 1-[4-(chloromethyl)-2,6-difluorophenyl]-2,2-dimethylpyrrolidine?
The InChIKey is JNPUMAMUOHEZRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClF2N/c1-13(2)4-3-5-17(13)12-10(15)6-9(8-14)7-11(12)16/h6-7H,3-5,8H2,1-2H3.
What are the key properties of 1-[4-(chloromethyl)-2,6-difluorophenyl]-2,2-dimethylpyrrolidine?
1-[4-(chloromethyl)-2,6-difluorophenyl]-2,2-dimethylpyrrolidine has a molecular weight of 259.73 g/mol, XLogP of 4.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(chloromethyl)-2,6-difluorophenyl]-2,2-dimethylpyrrolidine is sourced from PubChem (CID 63219563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).