C16H7Cl2F3O2 — CID 632203
2,4-dichloro-6-(trifluoromethyl)phenanthrene-9-carboxylic acid (PubChem CID 632203) has the molecular formula C16H7Cl2F3O2 and a molecular weight of 359.13 g/mol. Its IUPAC name is 2,4-dichloro-6-(trifluoromethyl)phenanthrene-9-carboxylic acid.
| Compound Name | 2,4-dichloro-6-(trifluoromethyl)phenanthrene-9-carboxylic acid |
|---|---|
| PubChem CID | 632203 |
| Molecular Formula | C16H7Cl2F3O2 |
| Molecular Weight | 359.13 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 2,4-dichloro-6-(trifluoromethyl)phenanthrene-9-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(Cl)cc(Cl)c2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C16H7Cl2F3O2/c17-9-3-7-4-12(15(22)23)10-2-1-8(16(19,20)21)5-11(10)14(7)13(18)6-9/h1-6H,(H,22,23) |
| InChIKey | VDGXLIUDQABHHL-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.13 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|