C12H15N7O2 — CID 63220958
1-[(4-amino-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-4-methylpiperazine-2,3-dione (PubChem CID 63220958) has the molecular formula C12H15N7O2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 1-[(4-amino-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-4-methylpiperazine-2,3-dione.
| Compound Name | 1-[(4-amino-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-4-methylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 63220958 |
| Molecular Formula | C12H15N7O2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-[(4-amino-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-4-methylpiperazine-2,3-dione |
| SMILES | CN1CCN(Cc2nc(N)c3cnn(C)c3n2)C(=O)C1=O |
| InChI | InChI=1S/C12H15N7O2/c1-17-3-4-19(12(21)11(17)20)6-8-15-9(13)7-5-14-18(2)10(7)16-8/h5H,3-4,6H2,1-2H3,(H2,13,15,16) |
| InChIKey | HISFYULSTVSGOP-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|