C10H13N9OS — CID 63221684
3-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methylsulfanyl]-4-methyl-1H-1,2,4-triazol-5-one (PubChem CID 63221684) has the molecular formula C10H13N9OS and a molecular weight of 307.34 g/mol. Its IUPAC name is 3-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methylsulfanyl]-4-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 3-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methylsulfanyl]-4-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 63221684 |
| Molecular Formula | C10H13N9OS |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methylsulfanyl]-4-methyl-1H-1,2,4-triazol-5-one |
| SMILES | Cn1c(SCc2nc(NN)c3cnn(C)c3n2)n[nH]c1=O |
| InChI | InChI=1S/C10H13N9OS/c1-18-9(20)16-17-10(18)21-4-6-13-7(15-11)5-3-12-19(2)8(5)14-6/h3H,4,11H2,1-2H3,(H,16,20)(H,13,14,15) |
| InChIKey | AHXNSGNFHMUJJS-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 132.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|