C11H14F3N3OS — CID 63221743
N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 63221743) has the molecular formula C11H14F3N3OS and a molecular weight of 293.31 g/mol. Its IUPAC name is N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 63221743 |
| Molecular Formula | C11H14F3N3OS |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | Cc1nc2sccn2c1CNCCOCC(F)(F)F |
| InChI | InChI=1S/C11H14F3N3OS/c1-8-9(17-3-5-19-10(17)16-8)6-15-2-4-18-7-11(12,13)14/h3,5,15H,2,4,6-7H2,1H3 |
| InChIKey | HHCJYNNEANEFIW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|