C10H17N3O2 — CID 63221785
1-[3-(piperidin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]ethanol (PubChem CID 63221785) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-[3-(piperidin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]ethanol.
| Compound Name | 1-[3-(piperidin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 63221785 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 1-[3-(piperidin-3-ylmethyl)-1,2,4-oxadiazol-5-yl]ethanol |
| SMILES | CC(O)c1nc(CC2CCCNC2)no1 |
| InChI | InChI=1S/C10H17N3O2/c1-7(14)10-12-9(13-15-10)5-8-3-2-4-11-6-8/h7-8,11,14H,2-6H2,1H3 |
| InChIKey | XGCQFZVZSYLFPP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |