C10H14F3N7 — CID 63222071
2,2,2-trifluoro-N-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-N-methylethanamine (PubChem CID 63222071) has the molecular formula C10H14F3N7 and a molecular weight of 289.27 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-N-methylethanamine.
| Compound Name | 2,2,2-trifluoro-N-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-N-methylethanamine |
|---|---|
| PubChem CID | 63222071 |
| Molecular Formula | C10H14F3N7 |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2,2,2-trifluoro-N-[(4-hydrazinyl-1-methylpyrazolo[3,4-d]pyrimidin-6-yl)methyl]-N-methylethanamine |
| SMILES | CN(Cc1nc(NN)c2cnn(C)c2n1)CC(F)(F)F |
| InChI | InChI=1S/C10H14F3N7/c1-19(5-10(11,12)13)4-7-16-8(18-14)6-3-15-20(2)9(6)17-7/h3H,4-5,14H2,1-2H3,(H,16,17,18) |
| InChIKey | KEKDYCWWNXOEBK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|