2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid

C13H8N2O2S — CID 63222493

IUPAC2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(-c2ccc3ccccc3n2)s1
InChIInChI=1S/C13H8N2O2S/c16-13(17)11-7-14-12(18-11)10-6-5-8-3-1-2-4-9(8)15-10/h1-7H,(H,16,17)
InChIKeyHZCRZNPAAMYCAN-UHFFFAOYSA-N
MW256.29 g/mol
LogP3.06
Rot. Bonds2

About 2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid

2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid (PubChem CID 63222493) has the molecular formula C13H8N2O2S and a molecular weight of 256.29 g/mol. Its IUPAC name is 2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid
PubChem CID63222493
Molecular FormulaC13H8N2O2S
Molecular Weight256.29 g/mol
Exact Mass256.03
IUPAC Name2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(-c2ccc3ccccc3n2)s1
InChIInChI=1S/C13H8N2O2S/c16-13(17)11-7-14-12(18-11)10-6-5-8-3-1-2-4-9(8)15-10/h1-7H,(H,16,17)
InChIKeyHZCRZNPAAMYCAN-UHFFFAOYSA-N
XLogP3.06
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.29
LogP ≤ 53.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid (CID 63222493) is 2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(-c2ccc3ccccc3n2)s1.
What is the InChIKey of 2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid?
The InChIKey is HZCRZNPAAMYCAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O2S/c16-13(17)11-7-14-12(18-11)10-6-5-8-3-1-2-4-9(8)15-10/h1-7H,(H,16,17).
What are the key properties of 2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid?
2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid has a molecular weight of 256.29 g/mol, XLogP of 3.06, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-quinolin-2-yl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 63222493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).