C16H20N2O3 — CID 63223027
4-[1-cyanopropan-2-yl(methyl)amino]-2-methyl-4-oxo-2-phenylbutanoic acid (PubChem CID 63223027) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-[1-cyanopropan-2-yl(methyl)amino]-2-methyl-4-oxo-2-phenylbutanoic acid.
| Compound Name | 4-[1-cyanopropan-2-yl(methyl)amino]-2-methyl-4-oxo-2-phenylbutanoic acid |
|---|---|
| PubChem CID | 63223027 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-[1-cyanopropan-2-yl(methyl)amino]-2-methyl-4-oxo-2-phenylbutanoic acid |
| SMILES | CC(CC#N)N(C)C(=O)CC(C)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O3/c1-12(9-10-17)18(3)14(19)11-16(2,15(20)21)13-7-5-4-6-8-13/h4-8,12H,9,11H2,1-3H3,(H,20,21) |
| InChIKey | ANNPOTPCTFHNDY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |