C12H18N2OS2 — CID 63223103
N-(4-amino-4-sulfanylidenebutan-2-yl)-5-ethyl-N-methylthiophene-2-carboxamide (PubChem CID 63223103) has the molecular formula C12H18N2OS2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N-(4-amino-4-sulfanylidenebutan-2-yl)-5-ethyl-N-methylthiophene-2-carboxamide.
| Compound Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-5-ethyl-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 63223103 |
| Molecular Formula | C12H18N2OS2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-5-ethyl-N-methylthiophene-2-carboxamide |
| SMILES | CCc1ccc(C(=O)N(C)C(C)CC(N)=S)s1 |
| InChI | InChI=1S/C12H18N2OS2/c1-4-9-5-6-10(17-9)12(15)14(3)8(2)7-11(13)16/h5-6,8H,4,7H2,1-3H3,(H2,13,16) |
| InChIKey | MDRLXEGGNVSTNO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|