About 3-[1,3-benzoxazol-2-yl(methyl)amino]-N'-hydroxybutanimidamide
3-[1,3-benzoxazol-2-yl(methyl)amino]-N'-hydroxybutanimidamide (PubChem CID 63223801) has the molecular formula C12H16N4O2
and a molecular weight of 248.29 g/mol. Its IUPAC name is 3-[1,3-benzoxazol-2-yl(methyl)amino]-N'-hydroxybutanimidamide.
Molecular Properties
| Compound Name | 3-[1,3-benzoxazol-2-yl(methyl)amino]-N'-hydroxybutanimidamide |
| PubChem CID | 63223801 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-[1,3-benzoxazol-2-yl(methyl)amino]-N'-hydroxybutanimidamide |
| SMILES | CC(C/C(N)=N/O)N(C)c1nc2ccccc2o1 |
| InChI | InChI=1S/C12H16N4O2/c1-8(7-11(13)15-17)16(2)12-14-9-5-3-4-6-10(9)18-12/h3-6,8,17H,7H2,1-2H3,(H2,13,15) |
| InChIKey | BKMQPGWKIXWICN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[1,3-benzoxazol-2-yl(methyl)amino]-N'-hydroxybutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,3-benzoxazol-2-yl(methyl)amino]-N'-hydroxybutanimidamide?
The IUPAC name of 3-[1,3-benzoxazol-2-yl(methyl)amino]-N'-hydroxybutanimidamide (CID 63223801) is 3-[1,3-benzoxazol-2-yl(methyl)amino]-N'-hydroxybutanimidamide.
What is the SMILES notation for 3-[1,3-benzoxazol-2-yl(methyl)amino]-N'-hydroxybutanimidamide?
The canonical SMILES for 3-[1,3-benzoxazol-2-yl(methyl)amino]-N'-hydroxybutanimidamide is CC(C/C(N)=N/O)N(C)c1nc2ccccc2o1.
What is the InChIKey of 3-[1,3-benzoxazol-2-yl(methyl)amino]-N'-hydroxybutanimidamide?
The InChIKey is BKMQPGWKIXWICN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O2/c1-8(7-11(13)15-17)16(2)12-14-9-5-3-4-6-10(9)18-12/h3-6,8,17H,7H2,1-2H3,(H2,13,15).
What are the key properties of 3-[1,3-benzoxazol-2-yl(methyl)amino]-N'-hydroxybutanimidamide?
3-[1,3-benzoxazol-2-yl(methyl)amino]-N'-hydroxybutanimidamide has a molecular weight of 248.29 g/mol, XLogP of 1.79, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,3-benzoxazol-2-yl(methyl)amino]-N'-hydroxybutanimidamide is sourced from PubChem (CID 63223801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).