C11H25N3 — CID 63225019
3-[3,3-dimethylbutyl(methyl)amino]butanimidamide (PubChem CID 63225019) has the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. Its IUPAC name is 3-[3,3-dimethylbutyl(methyl)amino]butanimidamide.
| Compound Name | 3-[3,3-dimethylbutyl(methyl)amino]butanimidamide |
|---|---|
| PubChem CID | 63225019 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | 3-[3,3-dimethylbutyl(methyl)amino]butanimidamide |
| SMILES | [H]/N=C(\N)CC(C)N(C)CCC(C)(C)C |
| InChI | InChI=1S/C11H25N3/c1-9(8-10(12)13)14(5)7-6-11(2,3)4/h9H,6-8H2,1-5H3,(H3,12,13) |
| InChIKey | PZSHBOCZFBLXKH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|