About 3-[4-(3,3,3-trifluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid
3-[4-(3,3,3-trifluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid (PubChem CID 63225909) has the molecular formula C9H12F3N3O4S
and a molecular weight of 315.27 g/mol. Its IUPAC name is 3-[4-(3,3,3-trifluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-(3,3,3-trifluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid |
| PubChem CID | 63225909 |
| Molecular Formula | C9H12F3N3O4S |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 3-[4-(3,3,3-trifluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1cc(S(=O)(=O)NCCC(F)(F)F)cn1 |
| InChI | InChI=1S/C9H12F3N3O4S/c10-9(11,12)2-3-14-20(18,19)7-5-13-15(6-7)4-1-8(16)17/h5-6,14H,1-4H2,(H,16,17) |
| InChIKey | HDVLENKTDULHPV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-(3,3,3-trifluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3,3,3-trifluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid?
The IUPAC name of 3-[4-(3,3,3-trifluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid (CID 63225909) is 3-[4-(3,3,3-trifluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid.
What is the SMILES notation for 3-[4-(3,3,3-trifluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid?
The canonical SMILES for 3-[4-(3,3,3-trifluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid is O=C(O)CCn1cc(S(=O)(=O)NCCC(F)(F)F)cn1.
What is the InChIKey of 3-[4-(3,3,3-trifluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid?
The InChIKey is HDVLENKTDULHPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3N3O4S/c10-9(11,12)2-3-14-20(18,19)7-5-13-15(6-7)4-1-8(16)17/h5-6,14H,1-4H2,(H,16,17).
What are the key properties of 3-[4-(3,3,3-trifluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid?
3-[4-(3,3,3-trifluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid has a molecular weight of 315.27 g/mol, XLogP of 0.59, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3,3,3-trifluoropropylsulfamoyl)pyrazol-1-yl]propanoic acid is sourced from PubChem (CID 63225909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).