C11H17F3N2S — CID 63226169
N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-3,3,3-trifluoropropan-1-amine (PubChem CID 63226169) has the molecular formula C11H17F3N2S and a molecular weight of 266.33 g/mol. Its IUPAC name is N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 63226169 |
| Molecular Formula | C11H17F3N2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-3,3,3-trifluoropropan-1-amine |
| SMILES | CC(C)(C)c1ncc(CNCCC(F)(F)F)s1 |
| InChI | InChI=1S/C11H17F3N2S/c1-10(2,3)9-16-7-8(17-9)6-15-5-4-11(12,13)14/h7,15H,4-6H2,1-3H3 |
| InChIKey | SNDHZSHGJOXCAX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|