C14H18F3NO — CID 63226189
1,7-dimethyl-3-(3,3,3-trifluoropropylamino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 63226189) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 1,7-dimethyl-3-(3,3,3-trifluoropropylamino)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1,7-dimethyl-3-(3,3,3-trifluoropropylamino)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 63226189 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1,7-dimethyl-3-(3,3,3-trifluoropropylamino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | Cc1ccc(O)c2c1C(C)CC2NCCC(F)(F)F |
| InChI | InChI=1S/C14H18F3NO/c1-8-3-4-11(19)13-10(7-9(2)12(8)13)18-6-5-14(15,16)17/h3-4,9-10,18-19H,5-7H2,1-2H3 |
| InChIKey | PFZHKCOKDZXXPW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|