C7H12F3NO3S — CID 63226280
1,1-dioxo-4-(3,3,3-trifluoropropylamino)thiolan-3-ol (PubChem CID 63226280) has the molecular formula C7H12F3NO3S and a molecular weight of 247.24 g/mol. Its IUPAC name is 1,1-dioxo-4-(3,3,3-trifluoropropylamino)thiolan-3-ol.
| Compound Name | 1,1-dioxo-4-(3,3,3-trifluoropropylamino)thiolan-3-ol |
|---|---|
| PubChem CID | 63226280 |
| Molecular Formula | C7H12F3NO3S |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 1,1-dioxo-4-(3,3,3-trifluoropropylamino)thiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(NCCC(F)(F)F)C1 |
| InChI | InChI=1S/C7H12F3NO3S/c8-7(9,10)1-2-11-5-3-15(13,14)4-6(5)12/h5-6,11-12H,1-4H2 |
| InChIKey | PIQMDJQXEAAHME-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |