C12H12F3N3O — CID 63226374
2-[(3,3,3-trifluoropropylamino)methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 63226374) has the molecular formula C12H12F3N3O and a molecular weight of 271.24 g/mol. Its IUPAC name is 2-[(3,3,3-trifluoropropylamino)methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[(3,3,3-trifluoropropylamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 63226374 |
| Molecular Formula | C12H12F3N3O |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-[(3,3,3-trifluoropropylamino)methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(CNCCC(F)(F)F)nc2ccccn12 |
| InChI | InChI=1S/C12H12F3N3O/c13-12(14,15)4-5-16-8-9-7-11(19)18-6-2-1-3-10(18)17-9/h1-3,6-7,16H,4-5,8H2 |
| InChIKey | NOPBMVDSHMVRAL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|