2-(3,3,3-trifluoropropylsulfamoyl)acetic acid

C5H8F3NO4S — CID 63226430

IUPAC2-(3,3,3-trifluoropropylsulfamoyl)acetic acid
SMILESO=C(O)CS(=O)(=O)NCCC(F)(F)F
InChIInChI=1S/C5H8F3NO4S/c6-5(7,8)1-2-9-14(12,13)3-4(10)11/h9H,1-3H2,(H,10,11)
InChIKeyPBUJOYVDPMWCOP-UHFFFAOYSA-N
MW235.18 g/mol
LogP-0.06
Rot. Bonds5

About 2-(3,3,3-trifluoropropylsulfamoyl)acetic acid

2-(3,3,3-trifluoropropylsulfamoyl)acetic acid (PubChem CID 63226430) has the molecular formula C5H8F3NO4S and a molecular weight of 235.18 g/mol. Its IUPAC name is 2-(3,3,3-trifluoropropylsulfamoyl)acetic acid.

Molecular Properties

Compound Name2-(3,3,3-trifluoropropylsulfamoyl)acetic acid
PubChem CID63226430
Molecular FormulaC5H8F3NO4S
Molecular Weight235.18 g/mol
Exact Mass235.01
IUPAC Name2-(3,3,3-trifluoropropylsulfamoyl)acetic acid
SMILESO=C(O)CS(=O)(=O)NCCC(F)(F)F
InChIInChI=1S/C5H8F3NO4S/c6-5(7,8)1-2-9-14(12,13)3-4(10)11/h9H,1-3H2,(H,10,11)
InChIKeyPBUJOYVDPMWCOP-UHFFFAOYSA-N
XLogP-0.06
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.18
LogP ≤ 5-0.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(3,3,3-trifluoropropylsulfamoyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,3,3-trifluoropropylsulfamoyl)acetic acid?
The IUPAC name of 2-(3,3,3-trifluoropropylsulfamoyl)acetic acid (CID 63226430) is 2-(3,3,3-trifluoropropylsulfamoyl)acetic acid.
What is the SMILES notation for 2-(3,3,3-trifluoropropylsulfamoyl)acetic acid?
The canonical SMILES for 2-(3,3,3-trifluoropropylsulfamoyl)acetic acid is O=C(O)CS(=O)(=O)NCCC(F)(F)F.
What is the InChIKey of 2-(3,3,3-trifluoropropylsulfamoyl)acetic acid?
The InChIKey is PBUJOYVDPMWCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F3NO4S/c6-5(7,8)1-2-9-14(12,13)3-4(10)11/h9H,1-3H2,(H,10,11).
What are the key properties of 2-(3,3,3-trifluoropropylsulfamoyl)acetic acid?
2-(3,3,3-trifluoropropylsulfamoyl)acetic acid has a molecular weight of 235.18 g/mol, XLogP of -0.06, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3,3-trifluoropropylsulfamoyl)acetic acid is sourced from PubChem (CID 63226430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).